| Catalog Number | ACM195071499 |
|---|---|
| Product Name | Amino-PEG4-CH2COOH |
| CAS Number | 195071-49-9 |
| Synonyms | Amino-PEG4-acetic acid |
| IUPAC Name | 2-[2-[2-[2-(2-Aminoethoxy)ethoxy]ethoxy]ethoxy]acetic acid |
| Molecular Weight | 251.28 |
| Molecular Formula | C10H21NO6 |
| Canonical SMILES | C(COCCOCCOCCOCC(=O)O)N |
| InChI | InChI=1S/C10H21NO6/c11-1-2-14-3-4-15-5-6-16-7-8-17-9-10(12)13/h1-9,11H2,(H,12,13) |
| InChI Key | NPRAKTLKDKKZAV-UHFFFAOYSA-N |
| Boiling Point | 397.6±32.0 °C |
| Purity | >90% |
| Density | 1.156±0.06 g/cm3 |
| Appearance | Liquid |
| Storage | -20±5 ºC |
| Description | Amino-PEG4-CH2COOH is also a non-cleavable 4 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). |
| Complexity | 178 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 251.13688739 |
| Heavy Atom Count | 17 |
| Monoisotopic Mass | 251.13688739 |
| Type | Heterobifunctional PEG Linkers |
| Topological Polar Surface Area | 100 Ų |
What is the molecular formula of 2,2,4,4,5-Pentabromodiphenyl ether?
The molecular formula is C12H5Br5O.
When was 2,2,4,4,5-Pentabromodiphenyl ether created and modified in PubChem?
It was created on 2005-08-08 and modified on 2023-12-30.
What are some synonyms for 2,2,4,4,5-Pentabromodiphenyl ether?
Some synonyms include PBDE 99 and BDE-99.
How is 1,2,4-Tribromo-5-(2,4-dibromophenoxy)benzene classified in the DFC?
It is classified as a Food Contaminant (code WG) in the DFC.
What is the IUPAC name of 2,2,4,4,5-Pentabromodiphenyl ether?
The IUPAC name is 1,2,4-tribromo-5-(2,4-dibromophenoxy)benzene.
What is the InChIKey of 2,2,4,4,5-Pentabromodiphenyl ether?
The InChIKey is WHPVYXDFIXRKLN-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,2,4,4,5-Pentabromodiphenyl ether?
The Canonical SMILES is C1=CC(=C(C=C1Br)Br)OC2=CC(=C(C=C2Br)Br)Br.
What is the CAS number of 2,2,4,4,5-Pentabromodiphenyl ether?
The CAS number is 60348-60-9.
What is the molecular weight of 2,2,4,4,5-Pentabromodiphenyl ether?
The molecular weight is 564.7 g/mol.
How many hydrogen bond acceptors and donors are there in 2,2,4,4,5-Pentabromodiphenyl ether?
There is 1 hydrogen bond acceptor and 0 donors in 2,2,4,4,5-Pentabromodiphenyl ether.
※ Please kindly note that our products are for research use only.
Privacy Policy | Cookie Policy | Copyright © 2024 Alfa Chemistry. All rights reserved.
